cas: 1000575-20-1 — see every product listed under this CAS number, including other names
4-Bromo-1-Chloro-2-(difluoromethoxy)benzene 95% (CAS 1000575-20-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A379589-250mg |
| cas | 1000575-20-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A379589 |
4-bromo-1-chloro-2-(difluoromethoxy)benzene (CAS 1000575-20-1) is a chemical compound with the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. IUPAC name: 4-bromo-1-chloro-2-(difluoromethoxy)benzene. InChIKey: NGPWNGKVKQXTBJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2O |
|---|---|
| Molecular weight | 257.46 g/mol |
| IUPAC name | 4-bromo-1-chloro-2-(difluoromethoxy)benzene |
| InChIKey | NGPWNGKVKQXTBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)F)Cl |
Computed by PubChem (NCBI)