cas: 5813-37-6 — see every product listed under this CAS number, including other names
4-Bromo-1-hydroxy-2-naphthoic acid 97% (CAS 5813-37-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A594708-100mg |
| cas | 5813-37-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2217.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A594708 |
4-bromo-1-hydroxynaphthalene-2-carboxylic acid (CAS 5813-37-6) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 4-bromo-1-hydroxynaphthalene-2-carboxylic acid. InChIKey: ORABWYPHDRBFAX-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 4-bromo-1-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | ORABWYPHDRBFAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)C(=O)O)Br |
Computed by PubChem (NCBI)