CAS 5813-37-6 appears in our catalog under these names: 4-Bromo-1-hydroxy-2-naphthoic acid, 95%, 4-Bromo-1-hydroxy-2-naphthoic acid, 97%, 4-bromo-1-hydroxynaphthalene-2-carboxylic acid, 4-Bromo-1-hydroxy-2-naphthoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g, 100mg.
4-bromo-1-hydroxynaphthalene-2-carboxylic acid (CAS 5813-37-6) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 4-bromo-1-hydroxynaphthalene-2-carboxylic acid. InChIKey: ORABWYPHDRBFAX-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 4-bromo-1-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | ORABWYPHDRBFAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)C(=O)O)Br |
Computed by PubChem (NCBI)