CAS 52938-96-2 appears in our catalog under these names: 5-(4-Bromophenyl)-2-furoic acid, 95%, 5-(4-Bromophenyl)furan-2-carboxylic acid, 97%, 5-(4-Bromophenyl)furan-2-carboxylic acid, 95%, 5-(4-Bromophenyl)-2-furoic acid, 99%(LC-MS),RG, 99%(LC-MS),RG, 5-(4-Bromophenyl)furan-2-carboxylic acid, 99%(LC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 500mg.
5-(4-bromophenyl)furan-2-carboxylic acid (CAS 52938-96-2) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 5-(4-bromophenyl)furan-2-carboxylic acid. InChIKey: MYPDSPQSFHXXTF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)furan-2-carboxylic acid |
| InChIKey | MYPDSPQSFHXXTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)O)Br |
Computed by PubChem (NCBI)