CAS 2199-93-1 appears in our catalog under these names: 3-Acetyl-6-bromocoumarin, 98%, 3–Acetyl–6–bromocoumarin, 3-Acetyl-6-bromocoumarin, >96.0%(GC), 3-ACETYL-6-BROMOCOUMARIN 98%, 3-Acetyl-6-bromo-2H-chromen-2-one, >97%, >97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 500 mg, 5 g.
3-acetyl-6-bromochromen-2-one (CAS 2199-93-1) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 3-acetyl-6-bromochromen-2-one. InChIKey: XFQYOFLFNKCHLG-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 3-acetyl-6-bromochromen-2-one |
| InChIKey | XFQYOFLFNKCHLG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)