4-Bromo-1-naphthalenecarboxylic acid, 97%
cas: 16650-55-8 — see every product listed under this CAS number, including other names
4-Bromo-1-naphthalenecarboxylic acid, 97% (CAS 16650-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A244892-1g |
| cas | 16650-55-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 236.88 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| Ambeed | 500g | 3107.12 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 253.27 Pln | |
| BLDpharm | 100g | 725.32 Pln | |
| BLDpharm | 500g | 3346.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-bromonaphthalene-1-carboxylic acid (CAS 16650-55-8) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 4-bromonaphthalene-1-carboxylic acid. InChIKey: FIJIPZQZVLCOMB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 4-bromonaphthalene-1-carboxylic acid |
| InChIKey | FIJIPZQZVLCOMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-1-naphthoic acid, 4-Bromo-1-naphthalenecarboxylic acid, 4-bromonaphthalene-1-carboxylic acid, 4-Bromo-1-Naphtalenecarboxylic Acid, 1-Naphthalenecarboxylic acid, 4-bromo-, 4-Bromo-1-naphthoicAcid, 4-bromo naphthoic acid, Afoxolaner Impurity 20, 4-bromo-naphthalic acid, 1-Naphthoic acid, 4-bromo-