cas: 885521-80-2 — see every product listed under this CAS number, including other names
4-Bromo-1H-indazole-3-carboxylic acid, 95% (CAS 885521-80-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225312-100MG |
| cas | 885521-80-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 500mg | 456.11 Pln | |
| Fluorochem | 1g | 471.73 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-1H-indazole-3-carboxylic acid (CAS 885521-80-2) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 4-bromo-1H-indazole-3-carboxylic acid. InChIKey: IQVZPISNPRYBGH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 4-bromo-1H-indazole-3-carboxylic acid |
| InChIKey | IQVZPISNPRYBGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)