Products 227016-67-3
CAS 227016-67-3 appears in our catalog under these names: 5-(Bromomethyl)-2-nitrobenzonitrile, 95%, 5-(Bromomethyl)-2-nitrobenzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 1000mg.
5-(bromomethyl)-2-nitrobenzonitrile (CAS 227016-67-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-(bromomethyl)-2-nitrobenzonitrile. InChIKey: RWDUSMOYLGEMCJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-(bromomethyl)-2-nitrobenzonitrile |
| InChIKey | RWDUSMOYLGEMCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)