CAS 331646-99-2 appears in our catalog under these names: 8-Bromoquinazoline-2,4(1h,3h)-dione, 95%, 8-Bromoquinazoline-2,4-diol, 95%, 8-Bromoquinazoline-2,4-diol 95%, 8-Bromoquinazoline-2,4-diol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 100g.
8-bromo-1H-quinazoline-2,4-dione (CAS 331646-99-2) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 8-bromo-1H-quinazoline-2,4-dione. InChIKey: XAKSYDAOQDFHDD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 8-bromo-1H-quinazoline-2,4-dione |
| InChIKey | XAKSYDAOQDFHDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)NC2=O |
Computed by PubChem (NCBI)