Products 885521-80-2
CAS 885521-80-2 appears in our catalog under these names: 4-Bromo-1h-indazole-3-carboxylic acid, 97%, 4–Bromo–1H–indazole–3–carboxylic acid, 4-Bromo-1H-indazole-3-carboxylic acid, 4-Bromo-1H-indazole-3-carboxylic acid 95%, 4-Bromo-1H-indazole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g, 2,5g, 10g, 500mg.
4-bromo-1H-indazole-3-carboxylic acid (CAS 885521-80-2) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 4-bromo-1H-indazole-3-carboxylic acid. InChIKey: IQVZPISNPRYBGH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 4-bromo-1H-indazole-3-carboxylic acid |
| InChIKey | IQVZPISNPRYBGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)