CAS 134914-92-4 is the registry number for 4-Bromo-2,6-bis(trifluoromethyl)pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
4-bromo-2,6-bis(trifluoromethyl)pyridine (CAS 134914-92-4) is a chemical compound with the molecular formula C7H2BrF6N and a molecular weight of 293.99 g/mol. IUPAC name: 4-bromo-2,6-bis(trifluoromethyl)pyridine. InChIKey: UZOZLEVNCJCYLZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF6N |
|---|---|
| Molecular weight | 293.99 g/mol |
| IUPAC name | 4-bromo-2,6-bis(trifluoromethyl)pyridine |
| InChIKey | UZOZLEVNCJCYLZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)