CAS 1099598-05-6 is the registry number for 5-Bromo-2,4-bis(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2,4-bis(trifluoromethyl)pyridine (CAS 1099598-05-6) is a chemical compound with the molecular formula C7H2BrF6N and a molecular weight of 293.99 g/mol. IUPAC name: 5-bromo-2,4-bis(trifluoromethyl)pyridine. InChIKey: QCEYYXFKCSHJEP-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF6N |
|---|---|
| Molecular weight | 293.99 g/mol |
| IUPAC name | 5-bromo-2,4-bis(trifluoromethyl)pyridine |
| InChIKey | QCEYYXFKCSHJEP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)