CAS 615580-46-6 is the registry number for 2-Bromo-4,6-bis(trifluoromethyl)pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,6-bis(trifluoromethyl)pyridine (CAS 615580-46-6) is a chemical compound with the molecular formula C7H2BrF6N and a molecular weight of 293.99 g/mol. IUPAC name: 2-bromo-4,6-bis(trifluoromethyl)pyridine. InChIKey: DJKFDNKTAXAXCL-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF6N |
|---|---|
| Molecular weight | 293.99 g/mol |
| IUPAC name | 2-bromo-4,6-bis(trifluoromethyl)pyridine |
| InChIKey | DJKFDNKTAXAXCL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)