CAS 1806378-86-8 is the registry number for 3-Bromo-2,6-bis(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-2,6-bis(trifluoromethyl)pyridine (CAS 1806378-86-8) is a chemical compound with the molecular formula C7H2BrF6N and a molecular weight of 293.99 g/mol. IUPAC name: 3-bromo-2,6-bis(trifluoromethyl)pyridine. InChIKey: NIYUWKCBQYYZRP-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF6N |
|---|---|
| Molecular weight | 293.99 g/mol |
| IUPAC name | 3-bromo-2,6-bis(trifluoromethyl)pyridine |
| InChIKey | NIYUWKCBQYYZRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)