cas: 161952-62-1 — see every product listed under this CAS number, including other names
4-Bromo-2-(2,2,2-trifluoroethoxy)pyridine 95% (CAS 161952-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230596-100mg |
| cas | 161952-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 887.69 Pln | |
| Ambeed | 5g | 2378.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230596 |
4-bromo-2-(2,2,2-trifluoroethoxy)pyridine (CAS 161952-62-1) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 4-bromo-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: QZFCOYMEICRTCT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 4-bromo-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | QZFCOYMEICRTCT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Br)OCC(F)(F)F |
Computed by PubChem (NCBI)