cas: 628326-12-5 — see every product listed under this CAS number, including other names
4-Bromo-2-(4-methylpiperazin-1-yl)benzaldehyde, 97% (CAS 628326-12-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 10g, 100mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A861093-25g |
| cas | 628326-12-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 7686.70 Pln | |
| AmBeed | 250mg | 525.70 Pln | |
| AmBeed | 10g | 3962.98 Pln | |
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 1g | 1070.47 Pln | |
| Fluorochem | 5g | 3007.29 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde (CAS 628326-12-5) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: NIOICRGSDAAJOW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 4-bromo-2-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | NIOICRGSDAAJOW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)Br)C=O |
Computed by PubChem (NCBI)