cas: 175278-09-8 — see every product listed under this CAS number, including other names
4-Bromo-2-(trifluoromethoxy)aniline 98% (CAS 175278-09-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A855674-5g |
| cas | 175278-09-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 181.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A855674 |
4-bromo-2-(trifluoromethoxy)aniline (CAS 175278-09-8) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 4-bromo-2-(trifluoromethoxy)aniline. InChIKey: QVILSWLYJYMGRN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethoxy)aniline |
| InChIKey | QVILSWLYJYMGRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)N |
Computed by PubChem (NCBI)