cas: 872820-00-3 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-5-nitroaniline 98% (CAS 872820-00-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A387471-1g |
| cas | 872820-00-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 759.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A387471 |
4-bromo-2-chloro-5-nitroaniline (CAS 872820-00-3) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-nitroaniline. InChIKey: OZMQSRBHILCYPE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-nitroaniline |
| InChIKey | OZMQSRBHILCYPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)Cl)N |
Computed by PubChem (NCBI)