cas: 872820-00-3 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-5-nitroaniline, 97%, 97% (CAS 872820-00-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PEJ-1g |
| cas | 872820-00-3 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 1077.20 Pln | |
| Chemat | 250mg | 93.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-chloro-5-nitroaniline (CAS 872820-00-3) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-nitroaniline. InChIKey: OZMQSRBHILCYPE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-nitroaniline |
| InChIKey | OZMQSRBHILCYPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)Cl)N |
Computed by PubChem (NCBI)