cas: 1261767-18-3 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-5-nitropyridine 95% (CAS 1261767-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A728331-100mg |
| cas | 1261767-18-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 10g | 3346.31 Pln | |
| Ambeed | 25g | 6795.06 Pln | |
| Ambeed | 100g | 21591.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A728331 |
4-bromo-2-chloro-5-nitropyridine (CAS 1261767-18-3) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 4-bromo-2-chloro-5-nitropyridine. InChIKey: DVBAUHSXNQFCQQ-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-nitropyridine |
| InChIKey | DVBAUHSXNQFCQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)