cas: 34033-41-5 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-6-nitroaniline, 96% (CAS 34033-41-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212044-100MG |
| cas | 34033-41-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 1565.09 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-chloro-6-nitroaniline (CAS 34033-41-5) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 4-bromo-2-chloro-6-nitroaniline. InChIKey: IZJHDXGYFMAJQJ-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-nitroaniline |
| InChIKey | IZJHDXGYFMAJQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Cl)Br |
Computed by PubChem (NCBI)