cas: 159329-03-0 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-3-(trifluoromethyl)aniline (CAS 159329-03-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F738168-1G |
| cas | 159329-03-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 4444.29 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2-fluoro-3-(trifluoromethyl)aniline (CAS 159329-03-0) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 4-bromo-2-fluoro-3-(trifluoromethyl)aniline. InChIKey: AZBUGWKAHLMONU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-(trifluoromethyl)aniline |
| InChIKey | AZBUGWKAHLMONU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)