cas: 159329-03-0 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-3-(trifluoromethyl)aniline, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 159329-03-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ADB8-250mg |
| cas | 159329-03-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2699.60 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-fluoro-3-(trifluoromethyl)aniline (CAS 159329-03-0) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 4-bromo-2-fluoro-3-(trifluoromethyl)aniline. InChIKey: AZBUGWKAHLMONU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-(trifluoromethyl)aniline |
| InChIKey | AZBUGWKAHLMONU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)