cas: 741698-83-9 — see every product listed under this CAS number, including other names
4-Bromo-2-isopropylbenzoic acid (CAS 741698-83-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069704-5G |
| cas | 741698-83-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 6037.48 Pln | |
| Fluorochem | 1g | 2059.71 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2-propan-2-ylbenzoic acid (CAS 741698-83-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 4-bromo-2-propan-2-ylbenzoic acid. InChIKey: ZVKWVPUYVKVUSM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 4-bromo-2-propan-2-ylbenzoic acid |
| InChIKey | ZVKWVPUYVKVUSM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)