cas: 103966-66-1 — see every product listed under this CAS number, including other names
4-Bromo-2-methoxy-1-nitrobenzene 98% (CAS 103966-66-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113901-500g |
| cas | 103966-66-1 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 4992.81 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1299.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A113901 |
4-bromo-2-methoxy-1-nitrobenzene (CAS 103966-66-1) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 4-bromo-2-methoxy-1-nitrobenzene. InChIKey: DJKPQYBFSAJUBS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-bromo-2-methoxy-1-nitrobenzene |
| InChIKey | DJKPQYBFSAJUBS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)