cas: 5002-26-6 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-1,1'-biphenyl, 95%+, 95%+ (CAS 5002-26-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KX9-250mg |
| cas | 5002-26-6 |
| size | 250mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 405.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-methyl-1-phenylbenzene (CAS 5002-26-6) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 4-bromo-2-methyl-1-phenylbenzene. InChIKey: ZBNARPVMXYNXQQ-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 4-bromo-2-methyl-1-phenylbenzene |
| InChIKey | ZBNARPVMXYNXQQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)