cas: 1256824-06-2 — see every product listed under this CAS number, including other names
4-Bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 98% (CAS 1256824-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338971-100MG |
| cas | 1256824-06-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 1216.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1256824-06-2) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 4-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: ANLSLNIHKSZKLF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | ANLSLNIHKSZKLF-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Br)C(=CN2)C(F)(F)F |
Computed by PubChem (NCBI)