cas: 2208-15-3 — see every product listed under this CAS number, including other names
4-Bromo-3-hydroxy-2-naphthoic Acid, 98%, 98% (CAS 2208-15-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KY0-1g |
| cas | 2208-15-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-hydroxynaphthalene-2-carboxylic acid (CAS 2208-15-3) is a chemical compound with the molecular formula C11H7BrO3 and a molecular weight of 267.07 g/mol. IUPAC name: 4-bromo-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: HBUFBIFPUAHIDX-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO3 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 4-bromo-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | HBUFBIFPUAHIDX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2Br)O)C(=O)O |
Computed by PubChem (NCBI)