cas: 741698-94-2 — see every product listed under this CAS number, including other names
4-Bromo-3-isopropylbenzoic acid, 95%, 95% (CAS 741698-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FEO9-100g |
| cas | 741698-94-2 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 13029.20 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1298.00 Pln | |
| Chemat | 25g | 4115.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-propan-2-ylbenzoic acid (CAS 741698-94-2) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 4-bromo-3-propan-2-ylbenzoic acid. InChIKey: AVLGNLUCRVKPGU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 4-bromo-3-propan-2-ylbenzoic acid |
| InChIKey | AVLGNLUCRVKPGU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)