cas: 92022-07-6 — see every product listed under this CAS number, including other names
4-Bromo-3-methyl-1,1'-biphenyl, 98%, 98% (CAS 92022-07-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GYFN-1g |
| cas | 92022-07-6 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 592.40 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 198.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-methyl-4-phenylbenzene (CAS 92022-07-6) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-bromo-2-methyl-4-phenylbenzene. InChIKey: XYXSPXSTVLIYNL-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-bromo-2-methyl-4-phenylbenzene |
| InChIKey | XYXSPXSTVLIYNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)