4-Bromo-9H-carbazole, 98%, 98%
cas: 3652-89-9 — see every product listed under this CAS number, including other names
4-Bromo-9H-carbazole, 98%, 98% (CAS 3652-89-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 50g, 1kg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140DD-200mg |
| cas | 3652-89-9 |
| size | 200mg |
| availability | 5000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 74.00 Pln | |
| Chemat | 50g | 909.20 Pln | |
| Chemat | 1kg | 11248.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 100g | 1749.20 Pln | |
| Chemat | 250g | 4197.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-9H-carbazole (CAS 3652-89-9) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 4-bromo-9H-carbazole. InChIKey: CBJHFGQCHKNNJY-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 4-bromo-9H-carbazole |
| InChIKey | CBJHFGQCHKNNJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC=C3Br |
Computed by PubChem (NCBI)