cas: 862470-12-0 — see every product listed under this CAS number, including other names
4-Bromo-N,N,2-trimethylbenzamide (CAS 862470-12-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619784-1G |
| cas | 862470-12-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2627.22 Pln | |
| Fluorochem | 5g | 7729.59 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-N,N,2-trimethylbenzamide (CAS 862470-12-0) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 4-bromo-N,N,2-trimethylbenzamide. InChIKey: VGPLBVZVZCUJPW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 4-bromo-N,N,2-trimethylbenzamide |
| InChIKey | VGPLBVZVZCUJPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)N(C)C |
Computed by PubChem (NCBI)