CAS 64835-48-9 is the registry number for N-Acetyl 4-bromo-3,5-dimethylaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
N-(4-bromo-3,5-dimethylphenyl)acetamide (CAS 64835-48-9) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: N-(4-bromo-3,5-dimethylphenyl)acetamide. InChIKey: HXXWQYBIQBWFDI-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | N-(4-bromo-3,5-dimethylphenyl)acetamide |
| InChIKey | HXXWQYBIQBWFDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)NC(=O)C |
Computed by PubChem (NCBI)