CAS 862470-12-0 appears in our catalog under these names: 4-Bromo-N,N,2-trimethylbenzamide, 96%, 4-Bromo-n,n,2-trimethylbenzamide, 98%, 4-Bromo-N,N,2-trimethylbenzamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-bromo-N,N,2-trimethylbenzamide (CAS 862470-12-0) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 4-bromo-N,N,2-trimethylbenzamide. InChIKey: VGPLBVZVZCUJPW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 4-bromo-N,N,2-trimethylbenzamide |
| InChIKey | VGPLBVZVZCUJPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)N(C)C |
Computed by PubChem (NCBI)