CAS 908257-16-9 is the registry number for 5-Bromo-n,n,2-trimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-N,N,2-trimethylbenzamide (CAS 908257-16-9) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 5-bromo-N,N,2-trimethylbenzamide. InChIKey: DVORDWPCULHVLF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 5-bromo-N,N,2-trimethylbenzamide |
| InChIKey | DVORDWPCULHVLF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C(=O)N(C)C |
Computed by PubChem (NCBI)