cas: 90944-62-0 — see every product listed under this CAS number, including other names
4-Bromo-N,N-diethylbenzenesulfonamide, 98% (CAS 90944-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212972-1G |
| cas | 90944-62-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-N,N-diethylbenzenesulfonamide (CAS 90944-62-0) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 4-bromo-N,N-diethylbenzenesulfonamide. InChIKey: NRGTZJXYAAGKQJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 4-bromo-N,N-diethylbenzenesulfonamide |
| InChIKey | NRGTZJXYAAGKQJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)