cas: 79606-46-5 — see every product listed under this CAS number, including other names
4-Bromo-N,N-diisopropylbenzamide, 98% (CAS 79606-46-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236064-1G |
| cas | 79606-46-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1143.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-N,N-di(propan-2-yl)benzamide (CAS 79606-46-5) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 4-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: ZRHGXOKPARSBQA-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 4-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | ZRHGXOKPARSBQA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)