cas: 65679-14-3 — see every product listed under this CAS number, including other names
4-Bromophenacyl thiocyanate, 98%, 98% (CAS 65679-14-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCNK-25g |
| cas | 65679-14-3 |
| size | 25g |
| availability | 275g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 5896.40 Pln | |
| Chemat | 5g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-(4-bromophenyl)-2-oxoethyl] thiocyanate (CAS 65679-14-3) is a chemical compound with the molecular formula C9H6BrNOS and a molecular weight of 256.12 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] thiocyanate. InChIKey: PIXLLQKMZXDTOU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNOS |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] thiocyanate |
| InChIKey | PIXLLQKMZXDTOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CSC#N)Br |
Computed by PubChem (NCBI)