CAS 1163703-60-3 is the registry number for 4-(5-Bromo-1,3-thiazol-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(5-bromo-1,3-thiazol-2-yl)phenol (CAS 1163703-60-3) is a chemical compound with the molecular formula C9H6BrNOS and a molecular weight of 256.12 g/mol. IUPAC name: 4-(5-bromo-1,3-thiazol-2-yl)phenol. InChIKey: OTIWQHTZWDPATF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNOS |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 4-(5-bromo-1,3-thiazol-2-yl)phenol |
| InChIKey | OTIWQHTZWDPATF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)Br)O |
Computed by PubChem (NCBI)