CAS 2265209-24-1 is the registry number for 1-(2-Bromo-5-thiocyanato-phenyl)-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-acetyl-4-bromophenyl) thiocyanate (CAS 2265209-24-1) is a chemical compound with the molecular formula C9H6BrNOS and a molecular weight of 256.12 g/mol. IUPAC name: (3-acetyl-4-bromophenyl) thiocyanate. InChIKey: KSTFJYHGNWSUMD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNOS |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | (3-acetyl-4-bromophenyl) thiocyanate |
| InChIKey | KSTFJYHGNWSUMD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)SC#N)Br |
Computed by PubChem (NCBI)