CAS 931966-96-0 appears in our catalog under these names: 5-(4-Bromophenyl)-2,3-dihydro-1,3-oxazole-2-thione, 95%, 5-(4-Bromophenyl)-2,3-dihydro-1,3-oxazole-2-thione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(4-bromophenyl)-3H-1,3-oxazole-2-thione (CAS 931966-96-0) is a chemical compound with the molecular formula C9H6BrNOS and a molecular weight of 256.12 g/mol. IUPAC name: 5-(4-bromophenyl)-3H-1,3-oxazole-2-thione. InChIKey: LGZAFDFORIFNJX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNOS |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3H-1,3-oxazole-2-thione |
| InChIKey | LGZAFDFORIFNJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=S)O2)Br |
Computed by PubChem (NCBI)