cas: 1196507-58-0 — see every product listed under this CAS number, including other names
4-CHLORO-5-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE, 98% (CAS 1196507-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331994-100MG |
| cas | 1196507-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 815.36 Pln | |
| Fluorochem | 1g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1196507-58-0) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: ATLADCFKPSZUNL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | ATLADCFKPSZUNL-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)C(F)(F)F |
Computed by PubChem (NCBI)