cas: 86110-26-1 — see every product listed under this CAS number, including other names
4-CHloro-Imidazo(1,5-A)Quinoxaline-3-Carboxylic Acid Ethyl Ester, 95% (CAS 86110-26-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A984202-5g |
| cas | 86110-26-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 42723.52 Pln | |
| AmBeed | 1g | 12256.72 Pln | |
| AmBeed | 250mg | 7348.18 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 4-chloroimidazo[1,5-a]quinoxaline-3-carboxylate (CAS 86110-26-1) is a chemical compound with the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. IUPAC name: ethyl 4-chloroimidazo[1,5-a]quinoxaline-3-carboxylate. InChIKey: OIHQPMNWYTYQTA-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2 |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | ethyl 4-chloroimidazo[1,5-a]quinoxaline-3-carboxylate |
| InChIKey | OIHQPMNWYTYQTA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=NC3=CC=CC=C3N2C=N1)Cl |
Computed by PubChem (NCBI)