CAS 117398-25-1 is the registry number for Ethyl 9-chloro-3H-imidazo[4,5-f]quinoline-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 9-chloro-6H-imidazo[4,5-f]quinoline-8-carboxylate (CAS 117398-25-1) is a chemical compound with the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. IUPAC name: ethyl 9-chloro-6H-imidazo[4,5-f]quinoline-8-carboxylate. InChIKey: XPQNGOYSXAYXHM-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2 |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | ethyl 9-chloro-6H-imidazo[4,5-f]quinoline-8-carboxylate |
| InChIKey | XPQNGOYSXAYXHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=CC=C3C(=NC=N3)C2=C1Cl |
Computed by PubChem (NCBI)