CAS 63002-59-5 is the registry number for 2-(Chloromethyl)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(chloromethyl)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole (CAS 63002-59-5) is a chemical compound with the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. IUPAC name: 2-(chloromethyl)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole. InChIKey: LGQHRDLTGASXNL-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O2 |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole |
| InChIKey | LGQHRDLTGASXNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=NN=C(O3)CCl |
Computed by PubChem (NCBI)