CAS 1429180-77-7 is the registry number for (R)-3-(2-Chloropyrimidin-4-yl)-4-phenyloxazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(4R)-3-(2-chloropyrimidin-4-yl)-4-phenyl-1,3-oxazolidin-2-one (CAS 1429180-77-7) is a chemical compound with the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. IUPAC name: (4R)-3-(2-chloropyrimidin-4-yl)-4-phenyl-1,3-oxazolidin-2-one. InChIKey: NWHBYLZBPGSARH-JTQLQIEISA-N.
| Molecular formula | C13H10ClN3O2 |
|---|---|
| Molecular weight | 275.69 g/mol |
| IUPAC name | (4R)-3-(2-chloropyrimidin-4-yl)-4-phenyl-1,3-oxazolidin-2-one |
| InChIKey | NWHBYLZBPGSARH-JTQLQIEISA-N |
| SMILES | C1[C@H](N(C(=O)O1)C2=NC(=NC=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)