cas: 4897-31-8 — see every product listed under this CAS number, including other names
4-Chloro-1-methyl-5-nitro-1H-imidazole, 97%, 97% (CAS 4897-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0TP-100mg |
| cas | 4897-31-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 1538.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-1-methyl-5-nitroimidazole (CAS 4897-31-8) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 4-chloro-1-methyl-5-nitroimidazole. InChIKey: BYQOKNIMGIDSHN-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 4-chloro-1-methyl-5-nitroimidazole |
| InChIKey | BYQOKNIMGIDSHN-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)