cas: 5334-48-5 — see every product listed under this CAS number, including other names
4-Chloro-1-phenyl-1H-pyrazolo[3,4-d]pyrimidine, 95%+, 95%+ (CAS 5334-48-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DG8I-50mg |
| cas | 5334-48-5 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1590.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-chloro-1-phenylpyrazolo[5,4-d]pyrimidine (CAS 5334-48-5) is a chemical compound with the molecular formula C11H7ClN4 and a molecular weight of 230.65 g/mol. IUPAC name: 4-chloro-1-phenylpyrazolo[5,4-d]pyrimidine. InChIKey: DEUTZSDRCGEUBP-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 4-chloro-1-phenylpyrazolo[5,4-d]pyrimidine |
| InChIKey | DEUTZSDRCGEUBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=N2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)