CAS 1296307-88-4 is the registry number for 6-Chloro-1-phenyl-1H-pyrazolo(3,4-d)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-1-phenylpyrazolo[3,4-d]pyrimidine (CAS 1296307-88-4) is a chemical compound with the molecular formula C11H7ClN4 and a molecular weight of 230.65 g/mol. IUPAC name: 6-chloro-1-phenylpyrazolo[3,4-d]pyrimidine. InChIKey: ZRORCSUKQUVXSG-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 6-chloro-1-phenylpyrazolo[3,4-d]pyrimidine |
| InChIKey | ZRORCSUKQUVXSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=NC(=NC=C3C=N2)Cl |
Computed by PubChem (NCBI)