CAS 28565-43-7 is the registry number for 7-Chloro-5-phenyl-(1,2,4)triazolo(1,5-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-chloro-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 28565-43-7) is a chemical compound with the molecular formula C11H7ClN4 and a molecular weight of 230.65 g/mol. IUPAC name: 7-chloro-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: PHVJNOYGIOXBRH-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 7-chloro-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | PHVJNOYGIOXBRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=NC=NN3C(=C2)Cl |
Computed by PubChem (NCBI)